C23H22F3NO2 — CID 174465393
3-(cyclopropylidenemethyl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole;ethyl formate (PubChem CID 174465393) has the molecular formula C23H22F3NO2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 3-(cyclopropylidenemethyl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole;ethyl formate.
| Compound Name | 3-(cyclopropylidenemethyl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole;ethyl formate |
|---|---|
| PubChem CID | 174465393 |
| Molecular Formula | C23H22F3NO2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 3-(cyclopropylidenemethyl)-1-[[3-(trifluoromethyl)phenyl]methyl]indole;ethyl formate |
| SMILES | CCOC=O.FC(F)(F)c1cccc(Cn2cc(C=C3CC3)c3ccccc32)c1 |
| InChI | InChI=1S/C20H16F3N.C3H6O2/c21-20(22,23)17-5-3-4-15(11-17)12-24-13-16(10-14-8-9-14)18-6-1-2-7-19(18)24;1-2-5-3-4/h1-7,10-11,13H,8-9,12H2;3H,2H2,1H3 |
| InChIKey | SVCDOGNNNYXCAA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|