C25H18F4N2O2 — CID 17234190
N-(3-fluoro-2-methylphenyl)-2-oxo-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetamide (PubChem CID 17234190) has the molecular formula C25H18F4N2O2 and a molecular weight of 454.42 g/mol. Its IUPAC name is N-(3-fluoro-2-methylphenyl)-2-oxo-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetamide.
| Compound Name | N-(3-fluoro-2-methylphenyl)-2-oxo-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 17234190 |
| Molecular Formula | C25H18F4N2O2 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-(3-fluoro-2-methylphenyl)-2-oxo-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetamide |
| SMILES | Cc1c(F)cccc1NC(=O)C(=O)c1cn(Cc2cccc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C25H18F4N2O2/c1-15-20(26)9-5-10-21(15)30-24(33)23(32)19-14-31(22-11-3-2-8-18(19)22)13-16-6-4-7-17(12-16)25(27,28)29/h2-12,14H,13H2,1H3,(H,30,33) |
| InChIKey | KENQARQLOWVEER-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|