C25H17F3N2O4 — CID 46786093
N-(1,3-benzodioxol-5-yl)-2-oxo-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetamide (PubChem CID 46786093) has the molecular formula C25H17F3N2O4 and a molecular weight of 466.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-oxo-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-oxo-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 46786093 |
| Molecular Formula | C25H17F3N2O4 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-oxo-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C(=O)c1cn(Cc2cccc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C25H17F3N2O4/c26-25(27,28)16-5-3-4-15(10-16)12-30-13-19(18-6-1-2-7-20(18)30)23(31)24(32)29-17-8-9-21-22(11-17)34-14-33-21/h1-11,13H,12,14H2,(H,29,32) |
| InChIKey | KJHOUMHSJRMWQS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|