C25H17F3N2O4 — CID 17264983
(Z)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-[3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enamide (PubChem CID 17264983) has the molecular formula C25H17F3N2O4 and a molecular weight of 466.42 g/mol. Its IUPAC name is (Z)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-[3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-[3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17264983 |
| Molecular Formula | C25H17F3N2O4 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (Z)-N-(1,3-benzodioxol-5-yl)-2-cyano-3-[3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1cccc(OCc2cccc(C(F)(F)F)c2)c1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H17F3N2O4/c26-25(27,28)19-5-1-4-17(10-19)14-32-21-6-2-3-16(11-21)9-18(13-29)24(31)30-20-7-8-22-23(12-20)34-15-33-22/h1-12H,14-15H2,(H,30,31)/b18-9- |
| InChIKey | MHZGRFOZWQFNLE-NVMNQCDNSA-N |
| XLogP | 5.56 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|