C35H22F3N5O8S — CID 42954761
(E)-3-(1,3-benzodioxol-5-yl)-N-[2-[[(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-cyanoprop-2-enamide (PubChem CID 42954761) has the molecular formula C35H22F3N5O8S and a molecular weight of 729.65 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[2-[[(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-[[(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 42954761 |
| Molecular Formula | C35H22F3N5O8S |
| Molecular Weight | 729.65 g/mol |
| Exact Mass | 729.11 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-[[(E)-3-(1,3-benzodioxol-5-yl)-2-cyanoprop-2-enoyl]amino]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCO2)C(=O)Nc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1NC(=O)/C(C#N)=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H22F3N5O8S/c36-35(37,38)24-2-1-3-25(14-24)43-52(46,47)26-6-7-27(41-33(44)22(16-39)10-20-4-8-29-31(12-20)50-18-48-29)28(15-26)42-34(45)23(17-40)11-21-5-9-30-32(13-21)51-19-49-30/h1-15,43H,18-19H2,(H,41,44)(H,42,45)/b22-10+,23-11+ |
| InChIKey | SYYJGEMJZYLOOB-CZGKVYIXSA-N |
| XLogP | 6.05 |
| TPSA | 188.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|