C22H15Cl2N3O3S — CID 6259731
(E)-N-[2-chloro-5-[(3-chlorophenyl)sulfamoyl]phenyl]-2-cyano-3-phenylprop-2-enamide (PubChem CID 6259731) has the molecular formula C22H15Cl2N3O3S and a molecular weight of 472.35 g/mol. Its IUPAC name is (E)-N-[2-chloro-5-[(3-chlorophenyl)sulfamoyl]phenyl]-2-cyano-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-chloro-5-[(3-chlorophenyl)sulfamoyl]phenyl]-2-cyano-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6259731 |
| Molecular Formula | C22H15Cl2N3O3S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | (E)-N-[2-chloro-5-[(3-chlorophenyl)sulfamoyl]phenyl]-2-cyano-3-phenylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1)C(=O)Nc1cc(S(=O)(=O)Nc2cccc(Cl)c2)ccc1Cl |
| InChI | InChI=1S/C22H15Cl2N3O3S/c23-17-7-4-8-18(12-17)27-31(29,30)19-9-10-20(24)21(13-19)26-22(28)16(14-25)11-15-5-2-1-3-6-15/h1-13,27H,(H,26,28)/b16-11+ |
| InChIKey | ZKHZSHRZUMZYOD-LFIBNONCSA-N |
| XLogP | 5.34 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|