C33H22F3N5O4S — CID 5015167
2-cyano-N-[2-[(2-cyano-3-phenylprop-2-enoyl)amino]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-3-phenylprop-2-enamide (PubChem CID 5015167) has the molecular formula C33H22F3N5O4S and a molecular weight of 641.63 g/mol. Its IUPAC name is 2-cyano-N-[2-[(2-cyano-3-phenylprop-2-enoyl)amino]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | 2-cyano-N-[2-[(2-cyano-3-phenylprop-2-enoyl)amino]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 5015167 |
| Molecular Formula | C33H22F3N5O4S |
| Molecular Weight | 641.63 g/mol |
| Exact Mass | 641.13 |
| IUPAC Name | 2-cyano-N-[2-[(2-cyano-3-phenylprop-2-enoyl)amino]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-3-phenylprop-2-enamide |
| SMILES | N#CC(=Cc1ccccc1)C(=O)Nc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1NC(=O)C(C#N)=Cc1ccccc1 |
| InChI | InChI=1S/C33H22F3N5O4S/c34-33(35,36)26-12-7-13-27(18-26)41-46(44,45)28-14-15-29(39-31(42)24(20-37)16-22-8-3-1-4-9-22)30(19-28)40-32(43)25(21-38)17-23-10-5-2-6-11-23/h1-19,41H,(H,39,42)(H,40,43) |
| InChIKey | XOPCGZOOYQMHJG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 151.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|