C22H16F3N3O4S — CID 1138629
(Z)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 1138629) has the molecular formula C22H16F3N3O4S and a molecular weight of 475.45 g/mol. Its IUPAC name is (Z)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1138629 |
| Molecular Formula | C22H16F3N3O4S |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | (Z)-3-[5-(benzenesulfonamidomethyl)furan-2-yl]-2-cyano-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(CNS(=O)(=O)c2ccccc2)o1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F3N3O4S/c23-22(24,25)16-5-4-6-17(12-16)28-21(29)15(13-26)11-18-9-10-19(32-18)14-27-33(30,31)20-7-2-1-3-8-20/h1-12,27H,14H2,(H,28,29)/b15-11- |
| InChIKey | NNMGHHQMNNMTHT-PTNGSMBKSA-N |
| XLogP | 4.32 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|