C23H21N3O4S — CID 1138734
(E)-N-benzyl-2-cyano-3-[5-[[(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]prop-2-enamide (PubChem CID 1138734) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is (E)-N-benzyl-2-cyano-3-[5-[[(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-2-cyano-3-[5-[[(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1138734 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (E)-N-benzyl-2-cyano-3-[5-[[(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccc(/C=C(\C#N)C(=O)NCc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C23H21N3O4S/c1-17-7-11-22(12-8-17)31(28,29)26-16-21-10-9-20(30-21)13-19(14-24)23(27)25-15-18-5-3-2-4-6-18/h2-13,26H,15-16H2,1H3,(H,25,27)/b19-13+ |
| InChIKey | ZCBQIWFQIWFHMW-CPNJWEJPSA-N |
| XLogP | 3.29 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|