C24H23N3O4S — CID 1136023
(Z)-2-cyano-3-[5-[[(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]-N-(2-phenylethyl)prop-2-enamide (PubChem CID 1136023) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-[[(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[5-[[(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 1136023 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | (Z)-2-cyano-3-[5-[[(4-methylphenyl)sulfonylamino]methyl]furan-2-yl]-N-(2-phenylethyl)prop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccc(/C=C(/C#N)C(=O)NCCc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C24H23N3O4S/c1-18-7-11-23(12-8-18)32(29,30)27-17-22-10-9-21(31-22)15-20(16-25)24(28)26-14-13-19-5-3-2-4-6-19/h2-12,15,27H,13-14,17H2,1H3,(H,26,28)/b20-15- |
| InChIKey | MHRCTPCNJBBTTO-HKWRFOASSA-N |
| XLogP | 3.33 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|