C16H11N3O3 — CID 25111369
(E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N-pyridin-2-ylprop-2-enamide (PubChem CID 25111369) has the molecular formula C16H11N3O3 and a molecular weight of 293.28 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N-pyridin-2-ylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 25111369 |
| Molecular Formula | C16H11N3O3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-cyano-N-pyridin-2-ylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccc2c(c1)OCO2)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C16H11N3O3/c17-9-12(16(20)19-15-3-1-2-6-18-15)7-11-4-5-13-14(8-11)22-10-21-13/h1-8H,10H2,(H,18,19,20)/b12-7+ |
| InChIKey | CKIZEERRWBNIPV-KPKJPENVSA-N |
| XLogP | 2.36 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|