C17H15N3O3 — CID 145487171
(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-imino-N-pyridin-2-ylbutanamide (PubChem CID 145487171) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-imino-N-pyridin-2-ylbutanamide.
| Compound Name | (2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-imino-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 145487171 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2Z)-2-(1,3-benzodioxol-5-ylmethylidene)-3-imino-N-pyridin-2-ylbutanamide |
| SMILES | [H]/N=C(C)/C(=C/c1ccc2c(c1)OCO2)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C17H15N3O3/c1-11(18)13(17(21)20-16-4-2-3-7-19-16)8-12-5-6-14-15(9-12)23-10-22-14/h2-9,18H,10H2,1H3,(H,19,20,21)/b13-8-,18-11+ |
| InChIKey | IBJVYKSQMAFQAP-QKEOZTRPSA-N |
| XLogP | 2.87 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|