C20H24N4O — CID 145487170
(2Z)-2-[[4-(diethylamino)phenyl]methylidene]-3-imino-N-pyridin-2-ylbutanamide (PubChem CID 145487170) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is (2Z)-2-[[4-(diethylamino)phenyl]methylidene]-3-imino-N-pyridin-2-ylbutanamide.
| Compound Name | (2Z)-2-[[4-(diethylamino)phenyl]methylidene]-3-imino-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 145487170 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (2Z)-2-[[4-(diethylamino)phenyl]methylidene]-3-imino-N-pyridin-2-ylbutanamide |
| SMILES | [H]/N=C(C)/C(=C/c1ccc(N(CC)CC)cc1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C20H24N4O/c1-4-24(5-2)17-11-9-16(10-12-17)14-18(15(3)21)20(25)23-19-8-6-7-13-22-19/h6-14,21H,4-5H2,1-3H3,(H,22,23,25)/b18-14-,21-15+ |
| InChIKey | BSJSTTYOMPEASZ-IVUDTHCKSA-N |
| XLogP | 3.99 |
| TPSA | 69.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|