C9H7N3O2 — CID 154274407
2-cyano-3-hydroxy-N-pyridin-2-ylprop-2-enamide (PubChem CID 154274407) has the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-cyano-3-hydroxy-N-pyridin-2-ylprop-2-enamide.
| Compound Name | 2-cyano-3-hydroxy-N-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 154274407 |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 2-cyano-3-hydroxy-N-pyridin-2-ylprop-2-enamide |
| SMILES | N#CC(=CO)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C9H7N3O2/c10-5-7(6-13)9(14)12-8-3-1-2-4-11-8/h1-4,6,13H,(H,11,12,14) |
| InChIKey | ZEJPAECJKUKOQJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|