C22H17N3O2 — CID 4878324
2-cyano-3-(2-phenylmethoxyphenyl)-N-pyridin-2-ylprop-2-enamide (PubChem CID 4878324) has the molecular formula C22H17N3O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-cyano-3-(2-phenylmethoxyphenyl)-N-pyridin-2-ylprop-2-enamide.
| Compound Name | 2-cyano-3-(2-phenylmethoxyphenyl)-N-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4878324 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-cyano-3-(2-phenylmethoxyphenyl)-N-pyridin-2-ylprop-2-enamide |
| SMILES | N#CC(=Cc1ccccc1OCc1ccccc1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C22H17N3O2/c23-15-19(22(26)25-21-12-6-7-13-24-21)14-18-10-4-5-11-20(18)27-16-17-8-2-1-3-9-17/h1-14H,16H2,(H,24,25,26) |
| InChIKey | YEUIIHNEPUKXLA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|