C21H22N2O3 — CID 7912298
(E)-2-cyano-N-(3-methoxypropyl)-3-(2-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 7912298) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (E)-2-cyano-N-(3-methoxypropyl)-3-(2-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3-methoxypropyl)-3-(2-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7912298 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E)-2-cyano-N-(3-methoxypropyl)-3-(2-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | COCCCNC(=O)/C(C#N)=C/c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H22N2O3/c1-25-13-7-12-23-21(24)19(15-22)14-18-10-5-6-11-20(18)26-16-17-8-3-2-4-9-17/h2-6,8-11,14H,7,12-13,16H2,1H3,(H,23,24)/b19-14+ |
| InChIKey | HIFZRHSQVZZYST-XMHGGMMESA-N |
| XLogP | 3.33 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|