C23H25BrN2O4 — CID 35770856
(E)-3-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)-2-cyano-N-(3-methoxypropyl)prop-2-enamide (PubChem CID 35770856) has the molecular formula C23H25BrN2O4 and a molecular weight of 473.37 g/mol. Its IUPAC name is (E)-3-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)-2-cyano-N-(3-methoxypropyl)prop-2-enamide.
| Compound Name | (E)-3-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)-2-cyano-N-(3-methoxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 35770856 |
| Molecular Formula | C23H25BrN2O4 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (E)-3-(3-bromo-5-ethoxy-4-phenylmethoxyphenyl)-2-cyano-N-(3-methoxypropyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)NCCCOC)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H25BrN2O4/c1-3-29-21-14-18(12-19(15-25)23(27)26-10-7-11-28-2)13-20(24)22(21)30-16-17-8-5-4-6-9-17/h4-6,8-9,12-14H,3,7,10-11,16H2,1-2H3,(H,26,27)/b19-12+ |
| InChIKey | UIGIHFNHKVLZKO-XDHOZWIPSA-N |
| XLogP | 4.49 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|