C27H24BrN3O5 — CID 126237097
(Z)-3-[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126237097) has the molecular formula C27H24BrN3O5 and a molecular weight of 550.41 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126237097 |
| Molecular Formula | C27H24BrN3O5 |
| Molecular Weight | 550.41 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | (Z)-3-[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)cc(Br)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H24BrN3O5/c1-35-25-16-21(13-22(17-29)27(32)30-12-6-10-19-7-3-2-4-8-19)15-24(28)26(25)36-18-20-9-5-11-23(14-20)31(33)34/h2-5,7-9,11,13-16H,6,10,12,18H2,1H3,(H,30,32)/b22-13- |
| InChIKey | HHFBJGZLSLXMMV-XKZIYDEJSA-N |
| XLogP | 5.60 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.41 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|