C19H15N5O2 — CID 53331315
(E)-2-cyano-3-(3-methoxy-1-phenylpyrazol-4-yl)-N-pyridin-2-ylprop-2-enamide (PubChem CID 53331315) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is (E)-2-cyano-3-(3-methoxy-1-phenylpyrazol-4-yl)-N-pyridin-2-ylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3-methoxy-1-phenylpyrazol-4-yl)-N-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 53331315 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (E)-2-cyano-3-(3-methoxy-1-phenylpyrazol-4-yl)-N-pyridin-2-ylprop-2-enamide |
| SMILES | COc1nn(-c2ccccc2)cc1/C=C(\C#N)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C19H15N5O2/c1-26-19-15(13-24(23-19)16-7-3-2-4-8-16)11-14(12-20)18(25)22-17-9-5-6-10-21-17/h2-11,13H,1H3,(H,21,22,25)/b14-11+ |
| InChIKey | QLDYCWKFADKFKY-SDNWHVSQSA-N |
| XLogP | 2.82 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|