C23H26F3N3O2 — CID 56551539
4-phenyl-1-[4-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-1-yl]butan-1-one (PubChem CID 56551539) has the molecular formula C23H26F3N3O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is 4-phenyl-1-[4-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-phenyl-1-[4-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 56551539 |
| Molecular Formula | C23H26F3N3O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-phenyl-1-[4-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1CCN(C(=O)CNc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H26F3N3O2/c24-23(25,26)19-9-5-10-20(16-19)27-17-22(31)29-14-12-28(13-15-29)21(30)11-4-8-18-6-2-1-3-7-18/h1-3,5-7,9-10,16,27H,4,8,11-15,17H2 |
| InChIKey | KSRYNXGBYFLBIR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |