C19H26F3N3O2 — CID 56552591
4-methyl-1-[4-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-1-yl]pentan-1-one (PubChem CID 56552591) has the molecular formula C19H26F3N3O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-methyl-1-[4-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-1-yl]pentan-1-one.
| Compound Name | 4-methyl-1-[4-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 56552591 |
| Molecular Formula | C19H26F3N3O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 4-methyl-1-[4-[2-[3-(trifluoromethyl)anilino]acetyl]piperazin-1-yl]pentan-1-one |
| SMILES | CC(C)CCC(=O)N1CCN(C(=O)CNc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H26F3N3O2/c1-14(2)6-7-17(26)24-8-10-25(11-9-24)18(27)13-23-16-5-3-4-15(12-16)19(20,21)22/h3-5,12,14,23H,6-11,13H2,1-2H3 |
| InChIKey | KLIZQHSQQDCNQY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |