C20H22F3N3O3 — CID 56551379
N-(furan-2-ylmethyl)-1-[2-[3-(trifluoromethyl)anilino]acetyl]piperidine-4-carboxamide (PubChem CID 56551379) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-[2-[3-(trifluoromethyl)anilino]acetyl]piperidine-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-[2-[3-(trifluoromethyl)anilino]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56551379 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-[2-[3-(trifluoromethyl)anilino]acetyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccco1)C1CCN(C(=O)CNc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H22F3N3O3/c21-20(22,23)15-3-1-4-16(11-15)24-13-18(27)26-8-6-14(7-9-26)19(28)25-12-17-5-2-10-29-17/h1-5,10-11,14,24H,6-9,12-13H2,(H,25,28) |
| InChIKey | DAJXZSIEIJXAMF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |