C22H25F3N2O3 — CID 56552560
1-[4-(2-ethoxyphenoxy)piperidin-1-yl]-2-[3-(trifluoromethyl)anilino]ethanone (PubChem CID 56552560) has the molecular formula C22H25F3N2O3 and a molecular weight of 422.45 g/mol. Its IUPAC name is 1-[4-(2-ethoxyphenoxy)piperidin-1-yl]-2-[3-(trifluoromethyl)anilino]ethanone.
| Compound Name | 1-[4-(2-ethoxyphenoxy)piperidin-1-yl]-2-[3-(trifluoromethyl)anilino]ethanone |
|---|---|
| PubChem CID | 56552560 |
| Molecular Formula | C22H25F3N2O3 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[4-(2-ethoxyphenoxy)piperidin-1-yl]-2-[3-(trifluoromethyl)anilino]ethanone |
| SMILES | CCOc1ccccc1OC1CCN(C(=O)CNc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H25F3N2O3/c1-2-29-19-8-3-4-9-20(19)30-18-10-12-27(13-11-18)21(28)15-26-17-7-5-6-16(14-17)22(23,24)25/h3-9,14,18,26H,2,10-13,15H2,1H3 |
| InChIKey | ZNYDEVWJGHPNOY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |