C19H29NO4 — CID 94669739
(2R)-2-ethoxy-1-[4-(2-ethoxyphenoxy)piperidin-1-yl]butan-1-one (PubChem CID 94669739) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is (2R)-2-ethoxy-1-[4-(2-ethoxyphenoxy)piperidin-1-yl]butan-1-one.
| Compound Name | (2R)-2-ethoxy-1-[4-(2-ethoxyphenoxy)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 94669739 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | (2R)-2-ethoxy-1-[4-(2-ethoxyphenoxy)piperidin-1-yl]butan-1-one |
| SMILES | CCOc1ccccc1OC1CCN(C(=O)[C@@H](CC)OCC)CC1 |
| InChI | InChI=1S/C19H29NO4/c1-4-16(22-5-2)19(21)20-13-11-15(12-14-20)24-18-10-8-7-9-17(18)23-6-3/h7-10,15-16H,4-6,11-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | UAAYYCGCKLHVOX-MRXNPFEDSA-N |
| XLogP | 3.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |