C23H27NO5S — CID 97233707
(2R)-2-[2-[4-(2-ethoxyphenoxy)piperidine-1-carbonyl]phenyl]sulfanylpropanoic acid (PubChem CID 97233707) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is (2R)-2-[2-[4-(2-ethoxyphenoxy)piperidine-1-carbonyl]phenyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-[2-[4-(2-ethoxyphenoxy)piperidine-1-carbonyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 97233707 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (2R)-2-[2-[4-(2-ethoxyphenoxy)piperidine-1-carbonyl]phenyl]sulfanylpropanoic acid |
| SMILES | CCOc1ccccc1OC1CCN(C(=O)c2ccccc2S[C@H](C)C(=O)O)CC1 |
| InChI | InChI=1S/C23H27NO5S/c1-3-28-19-9-5-6-10-20(19)29-17-12-14-24(15-13-17)22(25)18-8-4-7-11-21(18)30-16(2)23(26)27/h4-11,16-17H,3,12-15H2,1-2H3,(H,26,27)/t16-/m1/s1 |
| InChIKey | LDEANQWMHKYZDV-MRXNPFEDSA-N |
| XLogP | 4.33 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |