C19H27NO3S — CID 119185429
2-[2-(4-propan-2-ylazepane-1-carbonyl)phenyl]sulfanylpropanoic acid (PubChem CID 119185429) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is 2-[2-(4-propan-2-ylazepane-1-carbonyl)phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-(4-propan-2-ylazepane-1-carbonyl)phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 119185429 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-[2-(4-propan-2-ylazepane-1-carbonyl)phenyl]sulfanylpropanoic acid |
| SMILES | CC(Sc1ccccc1C(=O)N1CCCC(C(C)C)CC1)C(=O)O |
| InChI | InChI=1S/C19H27NO3S/c1-13(2)15-7-6-11-20(12-10-15)18(21)16-8-4-5-9-17(16)24-14(3)19(22)23/h4-5,8-9,13-15H,6-7,10-12H2,1-3H3,(H,22,23) |
| InChIKey | LMRDFZIOBSNAJH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |