C22H25NO3S — CID 119184330
2-[2-[4-(2-methylphenyl)piperidine-1-carbonyl]phenyl]sulfanylpropanoic acid (PubChem CID 119184330) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is 2-[2-[4-(2-methylphenyl)piperidine-1-carbonyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[4-(2-methylphenyl)piperidine-1-carbonyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 119184330 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-[2-[4-(2-methylphenyl)piperidine-1-carbonyl]phenyl]sulfanylpropanoic acid |
| SMILES | Cc1ccccc1C1CCN(C(=O)c2ccccc2SC(C)C(=O)O)CC1 |
| InChI | InChI=1S/C22H25NO3S/c1-15-7-3-4-8-18(15)17-11-13-23(14-12-17)21(24)19-9-5-6-10-20(19)27-16(2)22(25)26/h3-10,16-17H,11-14H2,1-2H3,(H,25,26) |
| InChIKey | PTHFICQZRPIQMZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |