C15H20F2N2OS — CID 166307242
[4-[(1R)-1-aminoethyl]piperidin-1-yl]-[2-(difluoromethylsulfanyl)phenyl]methanone (PubChem CID 166307242) has the molecular formula C15H20F2N2OS and a molecular weight of 314.40 g/mol. Its IUPAC name is [4-[(1R)-1-aminoethyl]piperidin-1-yl]-[2-(difluoromethylsulfanyl)phenyl]methanone.
| Compound Name | [4-[(1R)-1-aminoethyl]piperidin-1-yl]-[2-(difluoromethylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 166307242 |
| Molecular Formula | C15H20F2N2OS |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [4-[(1R)-1-aminoethyl]piperidin-1-yl]-[2-(difluoromethylsulfanyl)phenyl]methanone |
| SMILES | C[C@@H](N)C1CCN(C(=O)c2ccccc2SC(F)F)CC1 |
| InChI | InChI=1S/C15H20F2N2OS/c1-10(18)11-6-8-19(9-7-11)14(20)12-4-2-3-5-13(12)21-15(16)17/h2-5,10-11,15H,6-9,18H2,1H3/t10-/m1/s1 |
| InChIKey | NWRKAVNXLJCMGE-SNVBAGLBSA-N |
| XLogP | 3.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |