C25H35N7O4 — CID 167297546
1-[4-[5-[4-amino-3-(4-hydroxy-3,5-dimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]propan-1-one (PubChem CID 167297546) has the molecular formula C25H35N7O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is 1-[4-[5-[4-amino-3-(4-hydroxy-3,5-dimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[5-[4-amino-3-(4-hydroxy-3,5-dimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 167297546 |
| Molecular Formula | C25H35N7O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 1-[4-[5-[4-amino-3-(4-hydroxy-3,5-dimethoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(CCCCCn2nc(-c3cc(OC)c(O)c(OC)c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C25H35N7O4/c1-4-20(33)31-12-10-30(11-13-31)8-6-5-7-9-32-25-21(24(26)27-16-28-25)22(29-32)17-14-18(35-2)23(34)19(15-17)36-3/h14-16,34H,4-13H2,1-3H3,(H2,26,27,28) |
| InChIKey | LFUPBWBAYXSRSQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|