C29H42N8O2 — CID 167125645
3-(3,5-dimethoxyphenyl)-1-[5-[4-[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]piperazin-1-yl]pentyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 167125645) has the molecular formula C29H42N8O2 and a molecular weight of 534.71 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-1-[5-[4-[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]piperazin-1-yl]pentyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(3,5-dimethoxyphenyl)-1-[5-[4-[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]piperazin-1-yl]pentyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167125645 |
| Molecular Formula | C29H42N8O2 |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-1-[5-[4-[(3E)-5-(dimethylamino)penta-1,3-dien-2-yl]piperazin-1-yl]pentyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | C=C(/C=C/CN(C)C)N1CCN(CCCCCn2nc(-c3cc(OC)cc(OC)c3)c3c(N)ncnc32)CC1 |
| InChI | InChI=1S/C29H42N8O2/c1-22(10-9-11-34(2)3)36-16-14-35(15-17-36)12-7-6-8-13-37-29-26(28(30)31-21-32-29)27(33-37)23-18-24(38-4)20-25(19-23)39-5/h9-10,18-21H,1,6-8,11-17H2,2-5H3,(H2,30,31,32)/b10-9+ |
| InChIKey | RZSZUCDCDOZDLH-MDZDMXLPSA-N |
| XLogP | 3.51 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|