C15H23ClN2S — CID 2299558
1-[4-(4-chlorophenyl)sulfanylbutyl]-4-methylpiperazine (PubChem CID 2299558) has the molecular formula C15H23ClN2S and a molecular weight of 298.88 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)sulfanylbutyl]-4-methylpiperazine.
| Compound Name | 1-[4-(4-chlorophenyl)sulfanylbutyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 2299558 |
| Molecular Formula | C15H23ClN2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-[4-(4-chlorophenyl)sulfanylbutyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCCCSc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H23ClN2S/c1-17-9-11-18(12-10-17)8-2-3-13-19-15-6-4-14(16)5-7-15/h4-7H,2-3,8-13H2,1H3 |
| InChIKey | CJKRUZWLJDZUMZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|