C20H34ClN5S — CID 111372269
1-[2-(4-chlorophenyl)sulfanylethyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-methylguanidine (PubChem CID 111372269) has the molecular formula C20H34ClN5S and a molecular weight of 412.05 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111372269 |
| Molecular Formula | C20H34ClN5S |
| Molecular Weight | 412.05 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-2-methylguanidine |
| SMILES | CCN1CCN(CCCCN/C(=N/C)NCCSc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H34ClN5S/c1-3-25-13-15-26(16-14-25)12-5-4-10-23-20(22-2)24-11-17-27-19-8-6-18(21)7-9-19/h6-9H,3-5,10-17H2,1-2H3,(H2,22,23,24) |
| InChIKey | FSCPSWKDZCXVBF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.05 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|