C20H27ClN4OS — CID 111371817
1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine (PubChem CID 111371817) has the molecular formula C20H27ClN4OS and a molecular weight of 406.98 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine |
|---|---|
| PubChem CID | 111371817 |
| Molecular Formula | C20H27ClN4OS |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-2-methyl-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine |
| SMILES | C/N=C(/NCCCCn1c(C)cccc1=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H27ClN4OS/c1-16-6-5-7-19(26)25(16)14-4-3-12-23-20(22-2)24-13-15-27-18-10-8-17(21)9-11-18/h5-11H,3-4,12-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | CBTBCUUWZUNNIG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|