C19H26ClIN4O — CID 111174557
1-[(2-chlorophenyl)methyl]-2-methyl-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine;hydroiodide (PubChem CID 111174557) has the molecular formula C19H26ClIN4O and a molecular weight of 488.80 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-methyl-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111174557 |
| Molecular Formula | C19H26ClIN4O |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-[4-(2-methyl-6-oxo-1-pyridinyl)butyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCn1c(C)cccc1=O)NCc1ccccc1Cl.I |
| InChI | InChI=1S/C19H25ClN4O.HI/c1-15-8-7-11-18(25)24(15)13-6-5-12-22-19(21-2)23-14-16-9-3-4-10-17(16)20;/h3-4,7-11H,5-6,12-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | FHCSYYDJIWYPDR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|