C31H25NO6 — CID 139217703
diethyl 3-(1,3-benzodioxol-5-ylmethyl)naphtho[2,3-f]quinoline-1,2-dicarboxylate (PubChem CID 139217703) has the molecular formula C31H25NO6 and a molecular weight of 507.54 g/mol. Its IUPAC name is diethyl 3-(1,3-benzodioxol-5-ylmethyl)naphtho[2,3-f]quinoline-1,2-dicarboxylate.
| Compound Name | diethyl 3-(1,3-benzodioxol-5-ylmethyl)naphtho[2,3-f]quinoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139217703 |
| Molecular Formula | C31H25NO6 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | diethyl 3-(1,3-benzodioxol-5-ylmethyl)naphtho[2,3-f]quinoline-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(Cc2ccc3c(c2)OCO3)nc2ccc3cc4ccccc4cc3c2c1C(=O)OCC |
| InChI | InChI=1S/C31H25NO6/c1-3-35-30(33)28-24(13-18-9-12-25-26(14-18)38-17-37-25)32-23-11-10-21-15-19-7-5-6-8-20(19)16-22(21)27(23)29(28)31(34)36-4-2/h5-12,14-16H,3-4,13,17H2,1-2H3 |
| InChIKey | LMEKKSHWTHXRMZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|