C18H20ClN3O3S — CID 102102483
ethyl 4-(4-chlorophenyl)-6-methyl-2-morpholin-4-ylsulfanylpyrimidine-5-carboxylate (PubChem CID 102102483) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-6-methyl-2-morpholin-4-ylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-6-methyl-2-morpholin-4-ylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102102483 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-6-methyl-2-morpholin-4-ylsulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(SN2CCOCC2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3O3S/c1-3-25-17(23)15-12(2)20-18(26-22-8-10-24-11-9-22)21-16(15)13-4-6-14(19)7-5-13/h4-7H,3,8-11H2,1-2H3 |
| InChIKey | HCOPBNHRUQWPAJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|