C13H12N2O — CID 11481274
4-methoxy-1-methyl-9H-pyrido[3,4-b]indole (PubChem CID 11481274) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-methoxy-1-methyl-9H-pyrido[3,4-b]indole.
| Compound Name | 4-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11481274 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 4-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| SMILES | COc1cnc(C)c2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C13H12N2O/c1-8-13-12(11(16-2)7-14-8)9-5-3-4-6-10(9)15-13/h3-7,15H,1-2H3 |
| InChIKey | KYXCDOJUFJKHSO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |