About 4-methoxy-9H-pyrido[3,4-b]indol-8-ol
4-methoxy-9H-pyrido[3,4-b]indol-8-ol (PubChem CID 10798670) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-methoxy-9H-pyrido[3,4-b]indol-8-ol.
Molecular Properties
| Compound Name | 4-methoxy-9H-pyrido[3,4-b]indol-8-ol |
| PubChem CID | 10798670 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 4-methoxy-9H-pyrido[3,4-b]indol-8-ol |
| SMILES | COc1cncc2[nH]c3c(O)cccc3c12 |
| InChI | InChI=1S/C12H10N2O2/c1-16-10-6-13-5-8-11(10)7-3-2-4-9(15)12(7)14-8/h2-6,14-15H,1H3 |
| InChIKey | CKCCOVUDWGQLEP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-9H-pyrido[3,4-b]indol-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-9H-pyrido[3,4-b]indol-8-ol?
The IUPAC name of 4-methoxy-9H-pyrido[3,4-b]indol-8-ol (CID 10798670) is 4-methoxy-9H-pyrido[3,4-b]indol-8-ol.
What is the SMILES notation for 4-methoxy-9H-pyrido[3,4-b]indol-8-ol?
The canonical SMILES for 4-methoxy-9H-pyrido[3,4-b]indol-8-ol is COc1cncc2[nH]c3c(O)cccc3c12.
What is the InChIKey of 4-methoxy-9H-pyrido[3,4-b]indol-8-ol?
The InChIKey is CKCCOVUDWGQLEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c1-16-10-6-13-5-8-11(10)7-3-2-4-9(15)12(7)14-8/h2-6,14-15H,1H3.
What are the key properties of 4-methoxy-9H-pyrido[3,4-b]indol-8-ol?
4-methoxy-9H-pyrido[3,4-b]indol-8-ol has a molecular weight of 214.22 g/mol, XLogP of 2.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-9H-pyrido[3,4-b]indol-8-ol is sourced from PubChem (CID 10798670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).