C21H22N2O4S — CID 11429438
4-methoxy-1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium;4-methylbenzenesulfonate (PubChem CID 11429438) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 4-methoxy-1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium;4-methylbenzenesulfonate.
| Compound Name | 4-methoxy-1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11429438 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-methoxy-1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium;4-methylbenzenesulfonate |
| SMILES | COc1c[n+](C)c(C)c2[nH]c3ccccc3c12.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H14N2O.C7H8O3S/c1-9-14-13(12(17-3)8-16(9)2)10-6-4-5-7-11(10)15-14;1-6-2-4-7(5-3-6)11(8,9)10/h4-8H,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | PSBSFAQGDJQGCW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|