About 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one
4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one (PubChem CID 44887214) has the molecular formula C16H16N2O4S
and a molecular weight of 332.38 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one |
| PubChem CID | 44887214 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one |
| SMILES | C[n+]1cc2ccccc2c(=O)[nH]1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C9H8N2O.C7H8O3S/c1-11-6-7-4-2-3-5-8(7)9(12)10-11;1-6-2-4-7(5-3-6)11(8,9)10/h2-6H,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | AAQFMSAEUMGCED-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one?
The IUPAC name of 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one (CID 44887214) is 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one.
What is the SMILES notation for 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one?
The canonical SMILES for 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one is C[n+]1cc2ccccc2c(=O)[nH]1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one?
The InChIKey is AAQFMSAEUMGCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O.C7H8O3S/c1-11-6-7-4-2-3-5-8(7)9(12)10-11;1-6-2-4-7(5-3-6)11(8,9)10/h2-6H,1H3;2-5H,1H3,(H,8,9,10).
What are the key properties of 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one?
4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one has a molecular weight of 332.38 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;3-methyl-2H-phthalazin-3-ium-1-one is sourced from PubChem (CID 44887214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).