C22H24N2O4S — CID 11327403
2-ethyl-4-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium;4-methylbenzenesulfonate (PubChem CID 11327403) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-ethyl-4-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium;4-methylbenzenesulfonate.
| Compound Name | 2-ethyl-4-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11327403 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-ethyl-4-methoxy-1-methyl-9H-pyrido[3,4-b]indol-2-ium;4-methylbenzenesulfonate |
| SMILES | CC[n+]1cc(OC)c2c([nH]c3ccccc32)c1C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H16N2O.C7H8O3S/c1-4-17-9-13(18-3)14-11-7-5-6-8-12(11)16-15(14)10(17)2;1-6-2-4-7(5-3-6)11(8,9)10/h5-9H,4H2,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | NIIJJVOMZMWPGA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|