C19H20FNO3S — CID 161348124
1-ethyl-8-fluoro-4-methylquinolin-1-ium;4-methylbenzenesulfonate (PubChem CID 161348124) has the molecular formula C19H20FNO3S and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-ethyl-8-fluoro-4-methylquinolin-1-ium;4-methylbenzenesulfonate.
| Compound Name | 1-ethyl-8-fluoro-4-methylquinolin-1-ium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 161348124 |
| Molecular Formula | C19H20FNO3S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-ethyl-8-fluoro-4-methylquinolin-1-ium;4-methylbenzenesulfonate |
| SMILES | CC[n+]1ccc(C)c2cccc(F)c21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C12H13FN.C7H8O3S/c1-3-14-8-7-9(2)10-5-4-6-11(13)12(10)14;1-6-2-4-7(5-3-6)11(8,9)10/h4-8H,3H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | VNOPYGSZUMXSCZ-UHFFFAOYSA-M |
| XLogP | 3.49 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|