About 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate
2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate (PubChem CID 88724148) has the molecular formula C13H13ClINO3S
and a molecular weight of 425.68 g/mol. Its IUPAC name is 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate |
| PubChem CID | 88724148 |
| Molecular Formula | C13H13ClINO3S |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Clc1cccc[n+]1CI |
| InChI | InChI=1S/C7H8O3S.C6H6ClIN/c1-6-2-4-7(5-3-6)11(8,9)10;7-6-3-1-2-4-9(6)5-8/h2-5H,1H3,(H,8,9,10);1-4H,5H2/q;+1/p-1 |
| InChIKey | KDESPKFAGKNIJL-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate?
The IUPAC name of 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate (CID 88724148) is 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate.
What is the SMILES notation for 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate?
The canonical SMILES for 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)[O-])cc1.Clc1cccc[n+]1CI.
What is the InChIKey of 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate?
The InChIKey is KDESPKFAGKNIJL-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O3S.C6H6ClIN/c1-6-2-4-7(5-3-6)11(8,9)10;7-6-3-1-2-4-9(6)5-8/h2-5H,1H3,(H,8,9,10);1-4H,5H2/q;+1/p-1.
What are the key properties of 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate?
2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate has a molecular weight of 425.68 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-(iodomethyl)pyridin-1-ium;4-methylbenzenesulfonate is sourced from PubChem (CID 88724148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).