C34H30N2O4 — CID 20710151
methyl 4-(methylperoxymethyl)-2,5-bis(N-phenylanilino)benzoate (PubChem CID 20710151) has the molecular formula C34H30N2O4 and a molecular weight of 530.62 g/mol. Its IUPAC name is methyl 4-(methylperoxymethyl)-2,5-bis(N-phenylanilino)benzoate.
| Compound Name | methyl 4-(methylperoxymethyl)-2,5-bis(N-phenylanilino)benzoate |
|---|---|
| PubChem CID | 20710151 |
| Molecular Formula | C34H30N2O4 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | methyl 4-(methylperoxymethyl)-2,5-bis(N-phenylanilino)benzoate |
| SMILES | COOCc1cc(N(c2ccccc2)c2ccccc2)c(C(=O)OC)cc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H30N2O4/c1-38-34(37)31-24-32(35(27-15-7-3-8-16-27)28-17-9-4-10-18-28)26(25-40-39-2)23-33(31)36(29-19-11-5-12-20-29)30-21-13-6-14-22-30/h3-24H,25H2,1-2H3 |
| InChIKey | BLEOUHVVZYGJRV-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|