C32H26N4O4 — CID 167363539
1-N,4-N-dihydroxy-2,5-bis(N-phenylanilino)benzene-1,4-dicarboxamide (PubChem CID 167363539) has the molecular formula C32H26N4O4 and a molecular weight of 530.58 g/mol. Its IUPAC name is 1-N,4-N-dihydroxy-2,5-bis(N-phenylanilino)benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-dihydroxy-2,5-bis(N-phenylanilino)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 167363539 |
| Molecular Formula | C32H26N4O4 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 1-N,4-N-dihydroxy-2,5-bis(N-phenylanilino)benzene-1,4-dicarboxamide |
| SMILES | O=C(NO)c1cc(N(c2ccccc2)c2ccccc2)c(C(=O)NO)cc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H26N4O4/c37-31(33-39)27-22-30(36(25-17-9-3-10-18-25)26-19-11-4-12-20-26)28(32(38)34-40)21-29(27)35(23-13-5-1-6-14-23)24-15-7-2-8-16-24/h1-22,39-40H,(H,33,37)(H,34,38) |
| InChIKey | RTCBTTHXMHYZPD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|