C20H16N2O6 — CID 167363578
1-N,4-N-dihydroxy-2,5-diphenoxybenzene-1,4-dicarboxamide (PubChem CID 167363578) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 1-N,4-N-dihydroxy-2,5-diphenoxybenzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-dihydroxy-2,5-diphenoxybenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 167363578 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-N,4-N-dihydroxy-2,5-diphenoxybenzene-1,4-dicarboxamide |
| SMILES | O=C(NO)c1cc(Oc2ccccc2)c(C(=O)NO)cc1Oc1ccccc1 |
| InChI | InChI=1S/C20H16N2O6/c23-19(21-25)15-12-18(28-14-9-5-2-6-10-14)16(20(24)22-26)11-17(15)27-13-7-3-1-4-8-13/h1-12,25-26H,(H,21,23)(H,22,24) |
| InChIKey | CXPSJEKQSBPUNU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|