C16H14O5 — CID 23436153
dimethyl 2-phenoxybenzene-1,4-dicarboxylate (PubChem CID 23436153) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is dimethyl 2-phenoxybenzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-phenoxybenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 23436153 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | dimethyl 2-phenoxybenzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C16H14O5/c1-19-15(17)11-8-9-13(16(18)20-2)14(10-11)21-12-6-4-3-5-7-12/h3-10H,1-2H3 |
| InChIKey | GQHAGXIGLCZUHY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |