C31H28O6 — CID 174910592
diethyl 2-phenoxybenzene-1,4-dicarboxylate;diphenylmethanone (PubChem CID 174910592) has the molecular formula C31H28O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is diethyl 2-phenoxybenzene-1,4-dicarboxylate;diphenylmethanone.
| Compound Name | diethyl 2-phenoxybenzene-1,4-dicarboxylate;diphenylmethanone |
|---|---|
| PubChem CID | 174910592 |
| Molecular Formula | C31H28O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | diethyl 2-phenoxybenzene-1,4-dicarboxylate;diphenylmethanone |
| SMILES | CCOC(=O)c1ccc(C(=O)OCC)c(Oc2ccccc2)c1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18O5.C13H10O/c1-3-21-17(19)13-10-11-15(18(20)22-4-2)16(12-13)23-14-8-6-5-7-9-14;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h5-12H,3-4H2,1-2H3;1-10H |
| InChIKey | ROPJCDBEKOPXIT-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |