C24H20I2 — CID 129239066
6,12-diiodo-2,6,8,12-tetramethylindeno[1,2-b]fluorene (PubChem CID 129239066) has the molecular formula C24H20I2 and a molecular weight of 562.23 g/mol. Its IUPAC name is 6,12-diiodo-2,6,8,12-tetramethylindeno[1,2-b]fluorene.
| Compound Name | 6,12-diiodo-2,6,8,12-tetramethylindeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 129239066 |
| Molecular Formula | C24H20I2 |
| Molecular Weight | 562.23 g/mol |
| Exact Mass | 561.97 |
| IUPAC Name | 6,12-diiodo-2,6,8,12-tetramethylindeno[1,2-b]fluorene |
| SMILES | Cc1ccc2c(c1)C(C)(I)c1cc3c(cc1-2)C(C)(I)c1cc(C)ccc1-3 |
| InChI | InChI=1S/C24H20I2/c1-13-5-7-15-17-11-22-18(12-21(17)23(3,25)19(15)9-13)16-8-6-14(2)10-20(16)24(22,4)26/h5-12H,1-4H3 |
| InChIKey | GEPBALMVAVJENV-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.23 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|