C27H32O — CID 59611270
2,8-ditert-butyl-6,6-dimethylnaphtho[1,2-c]isochromene (PubChem CID 59611270) has the molecular formula C27H32O and a molecular weight of 372.55 g/mol. Its IUPAC name is 2,8-ditert-butyl-6,6-dimethylnaphtho[1,2-c]isochromene.
| Compound Name | 2,8-ditert-butyl-6,6-dimethylnaphtho[1,2-c]isochromene |
|---|---|
| PubChem CID | 59611270 |
| Molecular Formula | C27H32O |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2,8-ditert-butyl-6,6-dimethylnaphtho[1,2-c]isochromene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)Oc1c-2ccc2cc(C(C)(C)C)ccc12 |
| InChI | InChI=1S/C27H32O/c1-25(2,3)18-10-13-20-17(15-18)9-12-22-21-14-11-19(26(4,5)6)16-23(21)27(7,8)28-24(20)22/h9-16H,1-8H3 |
| InChIKey | CXRBPCOZIFWPMC-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |